C18H19FN2O2 — CID 60551809
N-[(2,4-dimethylphenyl)methyl]-N'-(3-fluoro-4-methylphenyl)oxamide (PubChem CID 60551809) has the molecular formula C18H19FN2O2 and a molecular weight of 314.36 g/mol. Its IUPAC name is N-[(2,4-dimethylphenyl)methyl]-N'-(3-fluoro-4-methylphenyl)oxamide.
| Compound Name | N-[(2,4-dimethylphenyl)methyl]-N'-(3-fluoro-4-methylphenyl)oxamide |
|---|---|
| PubChem CID | 60551809 |
| Molecular Formula | C18H19FN2O2 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | N-[(2,4-dimethylphenyl)methyl]-N'-(3-fluoro-4-methylphenyl)oxamide |
| SMILES | Cc1ccc(CNC(=O)C(=O)Nc2ccc(C)c(F)c2)c(C)c1 |
| InChI | InChI=1S/C18H19FN2O2/c1-11-4-6-14(13(3)8-11)10-20-17(22)18(23)21-15-7-5-12(2)16(19)9-15/h4-9H,10H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | NXRDNPNNGREGAJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|