C20H24N2O2 — CID 60551940
N-[(2,4-dimethylphenyl)methyl]-N'-(2-propan-2-ylphenyl)oxamide (PubChem CID 60551940) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is N-[(2,4-dimethylphenyl)methyl]-N'-(2-propan-2-ylphenyl)oxamide.
| Compound Name | N-[(2,4-dimethylphenyl)methyl]-N'-(2-propan-2-ylphenyl)oxamide |
|---|---|
| PubChem CID | 60551940 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | N-[(2,4-dimethylphenyl)methyl]-N'-(2-propan-2-ylphenyl)oxamide |
| SMILES | Cc1ccc(CNC(=O)C(=O)Nc2ccccc2C(C)C)c(C)c1 |
| InChI | InChI=1S/C20H24N2O2/c1-13(2)17-7-5-6-8-18(17)22-20(24)19(23)21-12-16-10-9-14(3)11-15(16)4/h5-11,13H,12H2,1-4H3,(H,21,23)(H,22,24) |
| InChIKey | VOXAQGQUYVRESF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|