C13H21N5O2S2 — CID 154770223
N-(1-ethylsulfonylpropan-2-yl)-N-methyl-1-(2-thiophen-2-ylethyl)tetrazol-5-amine (PubChem CID 154770223) has the molecular formula C13H21N5O2S2 and a molecular weight of 343.48 g/mol. Its IUPAC name is N-(1-ethylsulfonylpropan-2-yl)-N-methyl-1-(2-thiophen-2-ylethyl)tetrazol-5-amine.
| Compound Name | N-(1-ethylsulfonylpropan-2-yl)-N-methyl-1-(2-thiophen-2-ylethyl)tetrazol-5-amine |
|---|---|
| PubChem CID | 154770223 |
| Molecular Formula | C13H21N5O2S2 |
| Molecular Weight | 343.48 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | N-(1-ethylsulfonylpropan-2-yl)-N-methyl-1-(2-thiophen-2-ylethyl)tetrazol-5-amine |
| SMILES | CCS(=O)(=O)CC(C)N(C)c1nnnn1CCc1cccs1 |
| InChI | InChI=1S/C13H21N5O2S2/c1-4-22(19,20)10-11(2)17(3)13-14-15-16-18(13)8-7-12-6-5-9-21-12/h5-6,9,11H,4,7-8,10H2,1-3H3 |
| InChIKey | AIOGDHOQMLKZBX-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.48 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |