About N-(5-cyclopropyl-2-pyridinyl)-2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decane-9-carboxamide
N-(5-cyclopropyl-2-pyridinyl)-2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decane-9-carboxamide (PubChem CID 154770560) has the molecular formula C17H23N3O3S
and a molecular weight of 349.46 g/mol. Its IUPAC name is N-(5-cyclopropyl-2-pyridinyl)-2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decane-9-carboxamide.
Molecular Properties
| Compound Name | N-(5-cyclopropyl-2-pyridinyl)-2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decane-9-carboxamide |
| PubChem CID | 154770560 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | N-(5-cyclopropyl-2-pyridinyl)-2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decane-9-carboxamide |
| SMILES | O=C(Nc1ccc(C2CC2)cn1)N1CCCC2(CCS(=O)(=O)C2)C1 |
| InChI | InChI=1S/C17H23N3O3S/c21-16(19-15-5-4-14(10-18-15)13-2-3-13)20-8-1-6-17(11-20)7-9-24(22,23)12-17/h4-5,10,13H,1-3,6-9,11-12H2,(H,18,19,21) |
| InChIKey | CNZUHWBBDZALTH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(5-cyclopropyl-2-pyridinyl)-2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decane-9-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-cyclopropyl-2-pyridinyl)-2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decane-9-carboxamide?
The IUPAC name of N-(5-cyclopropyl-2-pyridinyl)-2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decane-9-carboxamide (CID 154770560) is N-(5-cyclopropyl-2-pyridinyl)-2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decane-9-carboxamide.
What is the SMILES notation for N-(5-cyclopropyl-2-pyridinyl)-2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decane-9-carboxamide?
The canonical SMILES for N-(5-cyclopropyl-2-pyridinyl)-2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decane-9-carboxamide is O=C(Nc1ccc(C2CC2)cn1)N1CCCC2(CCS(=O)(=O)C2)C1.
What is the InChIKey of N-(5-cyclopropyl-2-pyridinyl)-2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decane-9-carboxamide?
The InChIKey is CNZUHWBBDZALTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O3S/c21-16(19-15-5-4-14(10-18-15)13-2-3-13)20-8-1-6-17(11-20)7-9-24(22,23)12-17/h4-5,10,13H,1-3,6-9,11-12H2,(H,18,19,21).
What are the key properties of N-(5-cyclopropyl-2-pyridinyl)-2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decane-9-carboxamide?
N-(5-cyclopropyl-2-pyridinyl)-2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decane-9-carboxamide has a molecular weight of 349.46 g/mol, XLogP of 2.39, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-cyclopropyl-2-pyridinyl)-2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decane-9-carboxamide is sourced from PubChem (CID 154770560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).