C8H10N6OS — CID 154770631
2-(ethylamino)-N-(2H-triazol-4-yl)-1,3-thiazole-4-carboxamide (PubChem CID 154770631) has the molecular formula C8H10N6OS and a molecular weight of 238.28 g/mol. Its IUPAC name is 2-(ethylamino)-N-(2H-triazol-4-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(ethylamino)-N-(2H-triazol-4-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 154770631 |
| Molecular Formula | C8H10N6OS |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 2-(ethylamino)-N-(2H-triazol-4-yl)-1,3-thiazole-4-carboxamide |
| SMILES | CCNc1nc(C(=O)Nc2cn[nH]n2)cs1 |
| InChI | InChI=1S/C8H10N6OS/c1-2-9-8-11-5(4-16-8)7(15)12-6-3-10-14-13-6/h3-4H,2H2,1H3,(H,9,11)(H2,10,12,13,14,15) |
| InChIKey | YXWWMCNLRVVSCL-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |