About tert-butyl N-[1-[3-(2,4-dimethylpyrimidin-5-yl)prop-2-ynyl]piperidin-3-yl]carbamate
tert-butyl N-[1-[3-(2,4-dimethylpyrimidin-5-yl)prop-2-ynyl]piperidin-3-yl]carbamate (PubChem CID 154772001) has the molecular formula C19H28N4O2
and a molecular weight of 344.46 g/mol. Its IUPAC name is tert-butyl N-[1-[3-(2,4-dimethylpyrimidin-5-yl)prop-2-ynyl]piperidin-3-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[1-[3-(2,4-dimethylpyrimidin-5-yl)prop-2-ynyl]piperidin-3-yl]carbamate |
| PubChem CID | 154772001 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | tert-butyl N-[1-[3-(2,4-dimethylpyrimidin-5-yl)prop-2-ynyl]piperidin-3-yl]carbamate |
| SMILES | Cc1ncc(C#CCN2CCCC(NC(=O)OC(C)(C)C)C2)c(C)n1 |
| InChI | InChI=1S/C19H28N4O2/c1-14-16(12-20-15(2)21-14)8-6-10-23-11-7-9-17(13-23)22-18(24)25-19(3,4)5/h12,17H,7,9-11,13H2,1-5H3,(H,22,24) |
| InChIKey | KVUAEJWMONLTEI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[1-[3-(2,4-dimethylpyrimidin-5-yl)prop-2-ynyl]piperidin-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[1-[3-(2,4-dimethylpyrimidin-5-yl)prop-2-ynyl]piperidin-3-yl]carbamate?
The IUPAC name of tert-butyl N-[1-[3-(2,4-dimethylpyrimidin-5-yl)prop-2-ynyl]piperidin-3-yl]carbamate (CID 154772001) is tert-butyl N-[1-[3-(2,4-dimethylpyrimidin-5-yl)prop-2-ynyl]piperidin-3-yl]carbamate.
What is the SMILES notation for tert-butyl N-[1-[3-(2,4-dimethylpyrimidin-5-yl)prop-2-ynyl]piperidin-3-yl]carbamate?
The canonical SMILES for tert-butyl N-[1-[3-(2,4-dimethylpyrimidin-5-yl)prop-2-ynyl]piperidin-3-yl]carbamate is Cc1ncc(C#CCN2CCCC(NC(=O)OC(C)(C)C)C2)c(C)n1.
What is the InChIKey of tert-butyl N-[1-[3-(2,4-dimethylpyrimidin-5-yl)prop-2-ynyl]piperidin-3-yl]carbamate?
The InChIKey is KVUAEJWMONLTEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N4O2/c1-14-16(12-20-15(2)21-14)8-6-10-23-11-7-9-17(13-23)22-18(24)25-19(3,4)5/h12,17H,7,9-11,13H2,1-5H3,(H,22,24).
What are the key properties of tert-butyl N-[1-[3-(2,4-dimethylpyrimidin-5-yl)prop-2-ynyl]piperidin-3-yl]carbamate?
tert-butyl N-[1-[3-(2,4-dimethylpyrimidin-5-yl)prop-2-ynyl]piperidin-3-yl]carbamate has a molecular weight of 344.46 g/mol, XLogP of 2.43, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[1-[3-(2,4-dimethylpyrimidin-5-yl)prop-2-ynyl]piperidin-3-yl]carbamate is sourced from PubChem (CID 154772001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).