C14H20N4O3S — CID 154772400
3-[[6-(but-3-yn-2-ylsulfamoyl)-2-pyridinyl]amino]-2,2-dimethylpropanamide (PubChem CID 154772400) has the molecular formula C14H20N4O3S and a molecular weight of 324.41 g/mol. Its IUPAC name is 3-[[6-(but-3-yn-2-ylsulfamoyl)-2-pyridinyl]amino]-2,2-dimethylpropanamide.
| Compound Name | 3-[[6-(but-3-yn-2-ylsulfamoyl)-2-pyridinyl]amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 154772400 |
| Molecular Formula | C14H20N4O3S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 3-[[6-(but-3-yn-2-ylsulfamoyl)-2-pyridinyl]amino]-2,2-dimethylpropanamide |
| SMILES | C#CC(C)NS(=O)(=O)c1cccc(NCC(C)(C)C(N)=O)n1 |
| InChI | InChI=1S/C14H20N4O3S/c1-5-10(2)18-22(20,21)12-8-6-7-11(17-12)16-9-14(3,4)13(15)19/h1,6-8,10,18H,9H2,2-4H3,(H2,15,19)(H,16,17) |
| InChIKey | SYOFKBAJWCNMTB-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|