C21H45O13P — CID 154776161
(3S,4S,5R)-1-dimethoxyphosphoryl-3,4,5,7-tetrakis(ethoxymethoxy)heptane-2,6-diol (PubChem CID 154776161) has the molecular formula C21H45O13P and a molecular weight of 536.55 g/mol. Its IUPAC name is (3S,4S,5R)-1-dimethoxyphosphoryl-3,4,5,7-tetrakis(ethoxymethoxy)heptane-2,6-diol.
| Compound Name | (3S,4S,5R)-1-dimethoxyphosphoryl-3,4,5,7-tetrakis(ethoxymethoxy)heptane-2,6-diol |
|---|---|
| PubChem CID | 154776161 |
| Molecular Formula | C21H45O13P |
| Molecular Weight | 536.55 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | (3S,4S,5R)-1-dimethoxyphosphoryl-3,4,5,7-tetrakis(ethoxymethoxy)heptane-2,6-diol |
| SMILES | CCOCOCC(O)[C@@H](OCOCC)[C@H](OCOCC)[C@@H](OCOCC)C(O)CP(=O)(OC)OC |
| InChI | InChI=1S/C21H45O13P/c1-7-27-13-31-11-17(22)19(32-14-28-8-2)21(34-16-30-10-4)20(33-15-29-9-3)18(23)12-35(24,25-5)26-6/h17-23H,7-16H2,1-6H3/t17?,18?,19-,20+,21+/m1/s1 |
| InChIKey | SCLBCMCXPRADKK-KJFGXLEFSA-N |
| XLogP | 1.34 |
| TPSA | 149.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.55 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|