C17H18N4O4S — CID 154778690
3-hydroxy-N-[3-oxo-3-(3-oxo-4-thiophen-2-ylpiperazin-1-yl)propyl]pyridine-2-carboxamide (PubChem CID 154778690) has the molecular formula C17H18N4O4S and a molecular weight of 374.42 g/mol. Its IUPAC name is 3-hydroxy-N-[3-oxo-3-(3-oxo-4-thiophen-2-ylpiperazin-1-yl)propyl]pyridine-2-carboxamide.
| Compound Name | 3-hydroxy-N-[3-oxo-3-(3-oxo-4-thiophen-2-ylpiperazin-1-yl)propyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 154778690 |
| Molecular Formula | C17H18N4O4S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 3-hydroxy-N-[3-oxo-3-(3-oxo-4-thiophen-2-ylpiperazin-1-yl)propyl]pyridine-2-carboxamide |
| SMILES | O=C(NCCC(=O)N1CCN(c2cccs2)C(=O)C1)c1ncccc1O |
| InChI | InChI=1S/C17H18N4O4S/c22-12-3-1-6-18-16(12)17(25)19-7-5-13(23)20-8-9-21(14(24)11-20)15-4-2-10-26-15/h1-4,6,10,22H,5,7-9,11H2,(H,19,25) |
| InChIKey | DZFWUYMKYMCPKV-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |