C12H12N4O2S2 — CID 134161663
3-oxo-4-(1,3-thiazol-2-yl)-N-thiophen-2-ylpiperazine-1-carboxamide (PubChem CID 134161663) has the molecular formula C12H12N4O2S2 and a molecular weight of 308.39 g/mol. Its IUPAC name is 3-oxo-4-(1,3-thiazol-2-yl)-N-thiophen-2-ylpiperazine-1-carboxamide.
| Compound Name | 3-oxo-4-(1,3-thiazol-2-yl)-N-thiophen-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 134161663 |
| Molecular Formula | C12H12N4O2S2 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 3-oxo-4-(1,3-thiazol-2-yl)-N-thiophen-2-ylpiperazine-1-carboxamide |
| SMILES | O=C(Nc1cccs1)N1CCN(c2nccs2)C(=O)C1 |
| InChI | InChI=1S/C12H12N4O2S2/c17-10-8-15(11(18)14-9-2-1-6-19-9)4-5-16(10)12-13-3-7-20-12/h1-3,6-7H,4-5,8H2,(H,14,18) |
| InChIKey | PIDOKTFIGMFAGL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |