C14H17N5OS — CID 43468985
N-(4-aminophenyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboxamide (PubChem CID 43468985) has the molecular formula C14H17N5OS and a molecular weight of 303.39 g/mol. Its IUPAC name is N-(4-aminophenyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboxamide.
| Compound Name | N-(4-aminophenyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 43468985 |
| Molecular Formula | C14H17N5OS |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | N-(4-aminophenyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboxamide |
| SMILES | Nc1ccc(NC(=O)N2CCN(c3nccs3)CC2)cc1 |
| InChI | InChI=1S/C14H17N5OS/c15-11-1-3-12(4-2-11)17-13(20)18-6-8-19(9-7-18)14-16-5-10-21-14/h1-5,10H,6-9,15H2,(H,17,20) |
| InChIKey | ZFSGAUBGGKGWTK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|