C14H14Cl2N4OS — CID 47031878
N-(2,5-dichlorophenyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboxamide (PubChem CID 47031878) has the molecular formula C14H14Cl2N4OS and a molecular weight of 357.27 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboxamide.
| Compound Name | N-(2,5-dichlorophenyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 47031878 |
| Molecular Formula | C14H14Cl2N4OS |
| Molecular Weight | 357.27 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | N-(2,5-dichlorophenyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1Cl)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C14H14Cl2N4OS/c15-10-1-2-11(16)12(9-10)18-13(21)19-4-6-20(7-5-19)14-17-3-8-22-14/h1-3,8-9H,4-7H2,(H,18,21) |
| InChIKey | XXXIZCVLNCGLIF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.27 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |