C15H26F2N2O4 — CID 154778813
tert-butyl N-[2,2-difluoro-1-[4-methoxybutyl(methyl)carbamoyl]cyclopropyl]carbamate (PubChem CID 154778813) has the molecular formula C15H26F2N2O4 and a molecular weight of 336.38 g/mol. Its IUPAC name is tert-butyl N-[2,2-difluoro-1-[4-methoxybutyl(methyl)carbamoyl]cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[2,2-difluoro-1-[4-methoxybutyl(methyl)carbamoyl]cyclopropyl]carbamate |
|---|---|
| PubChem CID | 154778813 |
| Molecular Formula | C15H26F2N2O4 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | tert-butyl N-[2,2-difluoro-1-[4-methoxybutyl(methyl)carbamoyl]cyclopropyl]carbamate |
| SMILES | COCCCCN(C)C(=O)C1(NC(=O)OC(C)(C)C)CC1(F)F |
| InChI | InChI=1S/C15H26F2N2O4/c1-13(2,3)23-12(21)18-14(10-15(14,16)17)11(20)19(4)8-6-7-9-22-5/h6-10H2,1-5H3,(H,18,21) |
| InChIKey | BQDSSZMJEOZOTQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|