C13H15F3N2O3S — CID 154782226
N-[4-(trifluoromethyl)cyclohexyl]sulfonylpyridine-3-carboxamide (PubChem CID 154782226) has the molecular formula C13H15F3N2O3S and a molecular weight of 336.34 g/mol. Its IUPAC name is N-[4-(trifluoromethyl)cyclohexyl]sulfonylpyridine-3-carboxamide.
| Compound Name | N-[4-(trifluoromethyl)cyclohexyl]sulfonylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 154782226 |
| Molecular Formula | C13H15F3N2O3S |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | N-[4-(trifluoromethyl)cyclohexyl]sulfonylpyridine-3-carboxamide |
| SMILES | O=C(NS(=O)(=O)C1CCC(C(F)(F)F)CC1)c1cccnc1 |
| InChI | InChI=1S/C13H15F3N2O3S/c14-13(15,16)10-3-5-11(6-4-10)22(20,21)18-12(19)9-2-1-7-17-8-9/h1-2,7-8,10-11H,3-6H2,(H,18,19) |
| InChIKey | HDHOQYVMWLGFCX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |