C13H22N4OS — CID 154782778
6-amino-1-methyl-2-[2-(1-methylpiperidin-2-yl)ethylsulfanyl]pyrimidin-4-one (PubChem CID 154782778) has the molecular formula C13H22N4OS and a molecular weight of 282.41 g/mol. Its IUPAC name is 6-amino-1-methyl-2-[2-(1-methylpiperidin-2-yl)ethylsulfanyl]pyrimidin-4-one.
| Compound Name | 6-amino-1-methyl-2-[2-(1-methylpiperidin-2-yl)ethylsulfanyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 154782778 |
| Molecular Formula | C13H22N4OS |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 6-amino-1-methyl-2-[2-(1-methylpiperidin-2-yl)ethylsulfanyl]pyrimidin-4-one |
| SMILES | CN1CCCCC1CCSc1nc(=O)cc(N)n1C |
| InChI | InChI=1S/C13H22N4OS/c1-16-7-4-3-5-10(16)6-8-19-13-15-12(18)9-11(14)17(13)2/h9-10H,3-8,14H2,1-2H3 |
| InChIKey | OGMUMFDZFJPHQA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |