C15H27N3O5 — CID 154785811
methyl 3-[(1-cyclopentyl-2-hydroxyethoxy)carbamoylamino]piperidine-1-carboxylate (PubChem CID 154785811) has the molecular formula C15H27N3O5 and a molecular weight of 329.40 g/mol. Its IUPAC name is methyl 3-[(1-cyclopentyl-2-hydroxyethoxy)carbamoylamino]piperidine-1-carboxylate.
| Compound Name | methyl 3-[(1-cyclopentyl-2-hydroxyethoxy)carbamoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 154785811 |
| Molecular Formula | C15H27N3O5 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | methyl 3-[(1-cyclopentyl-2-hydroxyethoxy)carbamoylamino]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCCC(NC(=O)NOC(CO)C2CCCC2)C1 |
| InChI | InChI=1S/C15H27N3O5/c1-22-15(21)18-8-4-7-12(9-18)16-14(20)17-23-13(10-19)11-5-2-3-6-11/h11-13,19H,2-10H2,1H3,(H2,16,17,20) |
| InChIKey | OPMLAWUCFDBWMN-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|