C17H26N6O2 — CID 154785861
tert-butyl 8-(1-pent-4-ynyltetrazol-5-yl)-3,8-diazabicyclo[3.2.1]octane-3-carboxylate (PubChem CID 154785861) has the molecular formula C17H26N6O2 and a molecular weight of 346.44 g/mol. Its IUPAC name is tert-butyl 8-(1-pent-4-ynyltetrazol-5-yl)-3,8-diazabicyclo[3.2.1]octane-3-carboxylate.
| Compound Name | tert-butyl 8-(1-pent-4-ynyltetrazol-5-yl)-3,8-diazabicyclo[3.2.1]octane-3-carboxylate |
|---|---|
| PubChem CID | 154785861 |
| Molecular Formula | C17H26N6O2 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | tert-butyl 8-(1-pent-4-ynyltetrazol-5-yl)-3,8-diazabicyclo[3.2.1]octane-3-carboxylate |
| SMILES | C#CCCCn1nnnc1N1C2CCC1CN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C17H26N6O2/c1-5-6-7-10-22-15(18-19-20-22)23-13-8-9-14(23)12-21(11-13)16(24)25-17(2,3)4/h1,13-14H,6-12H2,2-4H3 |
| InChIKey | BESVFIYRSSVHAL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|