C17H20N4O2 — CID 154786031
2-cyclohexylidene-N-(1-methyl-5-oxo-4-phenyl-1,2,4-triazol-3-yl)acetamide (PubChem CID 154786031) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-cyclohexylidene-N-(1-methyl-5-oxo-4-phenyl-1,2,4-triazol-3-yl)acetamide.
| Compound Name | 2-cyclohexylidene-N-(1-methyl-5-oxo-4-phenyl-1,2,4-triazol-3-yl)acetamide |
|---|---|
| PubChem CID | 154786031 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 2-cyclohexylidene-N-(1-methyl-5-oxo-4-phenyl-1,2,4-triazol-3-yl)acetamide |
| SMILES | Cn1nc(NC(=O)C=C2CCCCC2)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C17H20N4O2/c1-20-17(23)21(14-10-6-3-7-11-14)16(19-20)18-15(22)12-13-8-4-2-5-9-13/h3,6-7,10-12H,2,4-5,8-9H2,1H3,(H,18,19,22) |
| InChIKey | IQLUTXVWIGTMCS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|