About ethyl 2-methyl-3,5-dioxo-4-phenyl-1,2,4-triazine-6-carboxylate
ethyl 2-methyl-3,5-dioxo-4-phenyl-1,2,4-triazine-6-carboxylate (PubChem CID 90397805) has the molecular formula C13H13N3O4
and a molecular weight of 275.26 g/mol. Its IUPAC name is ethyl 2-methyl-3,5-dioxo-4-phenyl-1,2,4-triazine-6-carboxylate.
Analyze ethyl 2-methyl-3,5-dioxo-4-phenyl-1,2,4-triazine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-methyl-3,5-dioxo-4-phenyl-1,2,4-triazine-6-carboxylate?
The IUPAC name of ethyl 2-methyl-3,5-dioxo-4-phenyl-1,2,4-triazine-6-carboxylate (CID 90397805) is ethyl 2-methyl-3,5-dioxo-4-phenyl-1,2,4-triazine-6-carboxylate.
What is the SMILES notation for ethyl 2-methyl-3,5-dioxo-4-phenyl-1,2,4-triazine-6-carboxylate?
The canonical SMILES for ethyl 2-methyl-3,5-dioxo-4-phenyl-1,2,4-triazine-6-carboxylate is CCOC(=O)c1nn(C)c(=O)n(-c2ccccc2)c1=O.
What is the InChIKey of ethyl 2-methyl-3,5-dioxo-4-phenyl-1,2,4-triazine-6-carboxylate?
The InChIKey is YAEGWHXRQHJQHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O4/c1-3-20-12(18)10-11(17)16(13(19)15(2)14-10)9-7-5-4-6-8-9/h4-8H,3H2,1-2H3.
What are the key properties of ethyl 2-methyl-3,5-dioxo-4-phenyl-1,2,4-triazine-6-carboxylate?
ethyl 2-methyl-3,5-dioxo-4-phenyl-1,2,4-triazine-6-carboxylate has a molecular weight of 275.26 g/mol, XLogP of 0.11, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-methyl-3,5-dioxo-4-phenyl-1,2,4-triazine-6-carboxylate is sourced from PubChem (CID 90397805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).