C19H34N2O3 — CID 154786689
N-[[4-(2,2-dimethylpent-4-enoyl)-2-methylmorpholin-2-yl]methyl]hexanamide (PubChem CID 154786689) has the molecular formula C19H34N2O3 and a molecular weight of 338.49 g/mol. Its IUPAC name is N-[[4-(2,2-dimethylpent-4-enoyl)-2-methylmorpholin-2-yl]methyl]hexanamide.
| Compound Name | N-[[4-(2,2-dimethylpent-4-enoyl)-2-methylmorpholin-2-yl]methyl]hexanamide |
|---|---|
| PubChem CID | 154786689 |
| Molecular Formula | C19H34N2O3 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | N-[[4-(2,2-dimethylpent-4-enoyl)-2-methylmorpholin-2-yl]methyl]hexanamide |
| SMILES | C=CCC(C)(C)C(=O)N1CCOC(C)(CNC(=O)CCCCC)C1 |
| InChI | InChI=1S/C19H34N2O3/c1-6-8-9-10-16(22)20-14-19(5)15-21(12-13-24-19)17(23)18(3,4)11-7-2/h7H,2,6,8-15H2,1,3-5H3,(H,20,22) |
| InChIKey | RAARLDJNYZBNHP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|