C25H34N2O2 — CID 154788121
N-[[1-(3,3-dimethylcyclobutanecarbonyl)-4-phenylpiperidin-4-yl]methyl]hex-5-ynamide (PubChem CID 154788121) has the molecular formula C25H34N2O2 and a molecular weight of 394.56 g/mol. Its IUPAC name is N-[[1-(3,3-dimethylcyclobutanecarbonyl)-4-phenylpiperidin-4-yl]methyl]hex-5-ynamide.
| Compound Name | N-[[1-(3,3-dimethylcyclobutanecarbonyl)-4-phenylpiperidin-4-yl]methyl]hex-5-ynamide |
|---|---|
| PubChem CID | 154788121 |
| Molecular Formula | C25H34N2O2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | N-[[1-(3,3-dimethylcyclobutanecarbonyl)-4-phenylpiperidin-4-yl]methyl]hex-5-ynamide |
| SMILES | C#CCCCC(=O)NCC1(c2ccccc2)CCN(C(=O)C2CC(C)(C)C2)CC1 |
| InChI | InChI=1S/C25H34N2O2/c1-4-5-7-12-22(28)26-19-25(21-10-8-6-9-11-21)13-15-27(16-14-25)23(29)20-17-24(2,3)18-20/h1,6,8-11,20H,5,7,12-19H2,2-3H3,(H,26,28) |
| InChIKey | RSTUYYIEFGAPTO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|