C15H12Cl2N4O — CID 154788580
5-[[5-(2,5-dichlorophenyl)-2-methoxyphenyl]methyl]-2H-tetrazole (PubChem CID 154788580) has the molecular formula C15H12Cl2N4O and a molecular weight of 335.19 g/mol. Its IUPAC name is 5-[[5-(2,5-dichlorophenyl)-2-methoxyphenyl]methyl]-2H-tetrazole.
| Compound Name | 5-[[5-(2,5-dichlorophenyl)-2-methoxyphenyl]methyl]-2H-tetrazole |
|---|---|
| PubChem CID | 154788580 |
| Molecular Formula | C15H12Cl2N4O |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 5-[[5-(2,5-dichlorophenyl)-2-methoxyphenyl]methyl]-2H-tetrazole |
| SMILES | COc1ccc(-c2cc(Cl)ccc2Cl)cc1Cc1nn[nH]n1 |
| InChI | InChI=1S/C15H12Cl2N4O/c1-22-14-5-2-9(12-8-11(16)3-4-13(12)17)6-10(14)7-15-18-20-21-19-15/h2-6,8H,7H2,1H3,(H,18,19,20,21) |
| InChIKey | CDMRLQLBXFLIRL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |