C9H9FN4O — CID 82126586
5-[(5-fluoro-2-methoxyphenyl)methyl]-2H-tetrazole (PubChem CID 82126586) has the molecular formula C9H9FN4O and a molecular weight of 208.20 g/mol. Its IUPAC name is 5-[(5-fluoro-2-methoxyphenyl)methyl]-2H-tetrazole.
| Compound Name | 5-[(5-fluoro-2-methoxyphenyl)methyl]-2H-tetrazole |
|---|---|
| PubChem CID | 82126586 |
| Molecular Formula | C9H9FN4O |
| Molecular Weight | 208.20 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 5-[(5-fluoro-2-methoxyphenyl)methyl]-2H-tetrazole |
| SMILES | COc1ccc(F)cc1Cc1nn[nH]n1 |
| InChI | InChI=1S/C9H9FN4O/c1-15-8-3-2-7(10)4-6(8)5-9-11-13-14-12-9/h2-4H,5H2,1H3,(H,11,12,13,14) |
| InChIKey | UEZZTWJRHHYURC-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.20 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |