C13H8BrCl3 — CID 134625631
2-(bromomethyl)-1-chloro-4-(2,5-dichlorophenyl)benzene (PubChem CID 134625631) has the molecular formula C13H8BrCl3 and a molecular weight of 350.47 g/mol. Its IUPAC name is 2-(bromomethyl)-1-chloro-4-(2,5-dichlorophenyl)benzene.
| Compound Name | 2-(bromomethyl)-1-chloro-4-(2,5-dichlorophenyl)benzene |
|---|---|
| PubChem CID | 134625631 |
| Molecular Formula | C13H8BrCl3 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 347.89 |
| IUPAC Name | 2-(bromomethyl)-1-chloro-4-(2,5-dichlorophenyl)benzene |
| SMILES | Clc1ccc(Cl)c(-c2ccc(Cl)c(CBr)c2)c1 |
| InChI | InChI=1S/C13H8BrCl3/c14-7-9-5-8(1-3-12(9)16)11-6-10(15)2-4-13(11)17/h1-6H,7H2 |
| InChIKey | TXZXLQSKHVULIE-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|