C13H15BrN4O2 — CID 154789281
N'-[2-(3-bromoimidazo[1,2-a]pyridin-2-yl)acetyl]-2-methylpropanehydrazide (PubChem CID 154789281) has the molecular formula C13H15BrN4O2 and a molecular weight of 339.19 g/mol. Its IUPAC name is N'-[2-(3-bromoimidazo[1,2-a]pyridin-2-yl)acetyl]-2-methylpropanehydrazide.
| Compound Name | N'-[2-(3-bromoimidazo[1,2-a]pyridin-2-yl)acetyl]-2-methylpropanehydrazide |
|---|---|
| PubChem CID | 154789281 |
| Molecular Formula | C13H15BrN4O2 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | N'-[2-(3-bromoimidazo[1,2-a]pyridin-2-yl)acetyl]-2-methylpropanehydrazide |
| SMILES | CC(C)C(=O)NNC(=O)Cc1nc2ccccn2c1Br |
| InChI | InChI=1S/C13H15BrN4O2/c1-8(2)13(20)17-16-11(19)7-9-12(14)18-6-4-3-5-10(18)15-9/h3-6,8H,7H2,1-2H3,(H,16,19)(H,17,20) |
| InChIKey | FQNXZOKWZCFYHM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|