C9H10Br2N4S — CID 45129671
[amino-[(3-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]methylidene]azanium bromide (PubChem CID 45129671) has the molecular formula C9H10Br2N4S and a molecular weight of 366.08 g/mol. Its IUPAC name is [amino-[(3-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]methylidene]azanium bromide.
| Compound Name | [amino-[(3-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]methylidene]azanium bromide |
|---|---|
| PubChem CID | 45129671 |
| Molecular Formula | C9H10Br2N4S |
| Molecular Weight | 366.08 g/mol |
| Exact Mass | 363.90 |
| IUPAC Name | [amino-[(3-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]methylidene]azanium bromide |
| SMILES | NC(=[NH2+])SCc1nc2ccccn2c1Br.[Br-] |
| InChI | InChI=1S/C9H9BrN4S.BrH/c10-8-6(5-15-9(11)12)13-7-3-1-2-4-14(7)8;/h1-4H,5H2,(H3,11,12);1H |
| InChIKey | ZTJXFTWAICUQHP-UHFFFAOYSA-N |
| XLogP | -2.59 |
| TPSA | 68.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.08 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|