About 1-[(3-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]phthalazine
1-[(3-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]phthalazine (PubChem CID 4277891) has the molecular formula C16H11BrN4S
and a molecular weight of 371.26 g/mol. Its IUPAC name is 1-[(3-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]phthalazine.
Molecular Properties
| Compound Name | 1-[(3-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]phthalazine |
| PubChem CID | 4277891 |
| Molecular Formula | C16H11BrN4S |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | 1-[(3-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]phthalazine |
| SMILES | Brc1c(CSc2nncc3ccccc23)nc2ccccn12 |
| InChI | InChI=1S/C16H11BrN4S/c17-15-13(19-14-7-3-4-8-21(14)15)10-22-16-12-6-2-1-5-11(12)9-18-20-16/h1-9H,10H2 |
| InChIKey | ISYFAJIQYMVNDD-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(3-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]phthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]phthalazine?
The IUPAC name of 1-[(3-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]phthalazine (CID 4277891) is 1-[(3-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]phthalazine.
What is the SMILES notation for 1-[(3-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]phthalazine?
The canonical SMILES for 1-[(3-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]phthalazine is Brc1c(CSc2nncc3ccccc23)nc2ccccn12.
What is the InChIKey of 1-[(3-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]phthalazine?
The InChIKey is ISYFAJIQYMVNDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11BrN4S/c17-15-13(19-14-7-3-4-8-21(14)15)10-22-16-12-6-2-1-5-11(12)9-18-20-16/h1-9H,10H2.
What are the key properties of 1-[(3-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]phthalazine?
1-[(3-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]phthalazine has a molecular weight of 371.26 g/mol, XLogP of 4.33, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]phthalazine is sourced from PubChem (CID 4277891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).