C10H15N9O — CID 154789313
1-[1-(1-methyltetrazol-5-yl)piperidin-4-yl]triazole-4-carboxamide (PubChem CID 154789313) has the molecular formula C10H15N9O and a molecular weight of 277.29 g/mol. Its IUPAC name is 1-[1-(1-methyltetrazol-5-yl)piperidin-4-yl]triazole-4-carboxamide.
| Compound Name | 1-[1-(1-methyltetrazol-5-yl)piperidin-4-yl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 154789313 |
| Molecular Formula | C10H15N9O |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 1-[1-(1-methyltetrazol-5-yl)piperidin-4-yl]triazole-4-carboxamide |
| SMILES | Cn1nnnc1N1CCC(n2cc(C(N)=O)nn2)CC1 |
| InChI | InChI=1S/C10H15N9O/c1-17-10(13-14-16-17)18-4-2-7(3-5-18)19-6-8(9(11)20)12-15-19/h6-7H,2-5H2,1H3,(H2,11,20) |
| InChIKey | HICWDYZJIRTZDW-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 120.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |