C12H22N6O2 — CID 67267284
tert-butyl-[1-(1-methyltetrazol-5-yl)piperidin-4-yl]carbamic acid (PubChem CID 67267284) has the molecular formula C12H22N6O2 and a molecular weight of 282.35 g/mol. Its IUPAC name is tert-butyl-[1-(1-methyltetrazol-5-yl)piperidin-4-yl]carbamic acid.
| Compound Name | tert-butyl-[1-(1-methyltetrazol-5-yl)piperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 67267284 |
| Molecular Formula | C12H22N6O2 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | tert-butyl-[1-(1-methyltetrazol-5-yl)piperidin-4-yl]carbamic acid |
| SMILES | Cn1nnnc1N1CCC(N(C(=O)O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C12H22N6O2/c1-12(2,3)18(11(19)20)9-5-7-17(8-6-9)10-13-14-15-16(10)4/h9H,5-8H2,1-4H3,(H,19,20) |
| InChIKey | VMPJYEXMJGUCAR-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |