methyl 1-(1-methyltetrazol-5-yl)pyrrolidine-3-carboxylate

C8H13N5O2 — CID 78949955

IUPACmethyl 1-(1-methyltetrazol-5-yl)pyrrolidine-3-carboxylate
SMILESCOC(=O)C1CCN(c2nnnn2C)C1
InChIInChI=1S/C8H13N5O2/c1-12-8(9-10-11-12)13-4-3-6(5-13)7(14)15-2/h6H,3-5H2,1-2H3
InChIKeyXNHIWKWEAMUAHA-UHFFFAOYSA-N
MW211.22 g/mol
LogP-0.79
Rot. Bonds2

About methyl 1-(1-methyltetrazol-5-yl)pyrrolidine-3-carboxylate

methyl 1-(1-methyltetrazol-5-yl)pyrrolidine-3-carboxylate (PubChem CID 78949955) has the molecular formula C8H13N5O2 and a molecular weight of 211.22 g/mol. Its IUPAC name is methyl 1-(1-methyltetrazol-5-yl)pyrrolidine-3-carboxylate.

Molecular Properties

Compound Namemethyl 1-(1-methyltetrazol-5-yl)pyrrolidine-3-carboxylate
PubChem CID78949955
Molecular FormulaC8H13N5O2
Molecular Weight211.22 g/mol
Exact Mass211.11
IUPAC Namemethyl 1-(1-methyltetrazol-5-yl)pyrrolidine-3-carboxylate
SMILESCOC(=O)C1CCN(c2nnnn2C)C1
InChIInChI=1S/C8H13N5O2/c1-12-8(9-10-11-12)13-4-3-6(5-13)7(14)15-2/h6H,3-5H2,1-2H3
InChIKeyXNHIWKWEAMUAHA-UHFFFAOYSA-N
XLogP-0.79
TPSA73.14 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.22
LogP ≤ 5-0.79
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Analyze methyl 1-(1-methyltetrazol-5-yl)pyrrolidine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-(1-methyltetrazol-5-yl)pyrrolidine-3-carboxylate?
The IUPAC name of methyl 1-(1-methyltetrazol-5-yl)pyrrolidine-3-carboxylate (CID 78949955) is methyl 1-(1-methyltetrazol-5-yl)pyrrolidine-3-carboxylate.
What is the SMILES notation for methyl 1-(1-methyltetrazol-5-yl)pyrrolidine-3-carboxylate?
The canonical SMILES for methyl 1-(1-methyltetrazol-5-yl)pyrrolidine-3-carboxylate is COC(=O)C1CCN(c2nnnn2C)C1.
What is the InChIKey of methyl 1-(1-methyltetrazol-5-yl)pyrrolidine-3-carboxylate?
The InChIKey is XNHIWKWEAMUAHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N5O2/c1-12-8(9-10-11-12)13-4-3-6(5-13)7(14)15-2/h6H,3-5H2,1-2H3.
What are the key properties of methyl 1-(1-methyltetrazol-5-yl)pyrrolidine-3-carboxylate?
methyl 1-(1-methyltetrazol-5-yl)pyrrolidine-3-carboxylate has a molecular weight of 211.22 g/mol, XLogP of -0.79, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(1-methyltetrazol-5-yl)pyrrolidine-3-carboxylate is sourced from PubChem (CID 78949955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).