C24H32N2O — CID 154794005
3-(dimethylamino)-1-[3-methyl-2-(4-methylphenyl)piperidin-1-yl]-3-phenylpropan-1-one (PubChem CID 154794005) has the molecular formula C24H32N2O and a molecular weight of 364.53 g/mol. Its IUPAC name is 3-(dimethylamino)-1-[3-methyl-2-(4-methylphenyl)piperidin-1-yl]-3-phenylpropan-1-one.
| Compound Name | 3-(dimethylamino)-1-[3-methyl-2-(4-methylphenyl)piperidin-1-yl]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 154794005 |
| Molecular Formula | C24H32N2O |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | 3-(dimethylamino)-1-[3-methyl-2-(4-methylphenyl)piperidin-1-yl]-3-phenylpropan-1-one |
| SMILES | Cc1ccc(C2C(C)CCCN2C(=O)CC(c2ccccc2)N(C)C)cc1 |
| InChI | InChI=1S/C24H32N2O/c1-18-12-14-21(15-13-18)24-19(2)9-8-16-26(24)23(27)17-22(25(3)4)20-10-6-5-7-11-20/h5-7,10-15,19,22,24H,8-9,16-17H2,1-4H3 |
| InChIKey | OUYSQWQHSBCUEL-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |