C18H18N4O3 — CID 154794228
6-(3-pyridin-4-ylpiperazine-1-carbonyl)-4H-1,4-benzoxazin-3-one (PubChem CID 154794228) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is 6-(3-pyridin-4-ylpiperazine-1-carbonyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(3-pyridin-4-ylpiperazine-1-carbonyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 154794228 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 6-(3-pyridin-4-ylpiperazine-1-carbonyl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(C(=O)N3CCNC(c4ccncc4)C3)cc2N1 |
| InChI | InChI=1S/C18H18N4O3/c23-17-11-25-16-2-1-13(9-14(16)21-17)18(24)22-8-7-20-15(10-22)12-3-5-19-6-4-12/h1-6,9,15,20H,7-8,10-11H2,(H,21,23) |
| InChIKey | QMHZDFHYXUVWGS-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |