C23H27N3O — CID 154794407
(2S,3S)-N-(1,3-diphenylpropan-2-yl)-2-(1-methylimidazol-2-yl)oxolan-3-amine (PubChem CID 154794407) has the molecular formula C23H27N3O and a molecular weight of 361.49 g/mol. Its IUPAC name is (2S,3S)-N-(1,3-diphenylpropan-2-yl)-2-(1-methylimidazol-2-yl)oxolan-3-amine.
| Compound Name | (2S,3S)-N-(1,3-diphenylpropan-2-yl)-2-(1-methylimidazol-2-yl)oxolan-3-amine |
|---|---|
| PubChem CID | 154794407 |
| Molecular Formula | C23H27N3O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | (2S,3S)-N-(1,3-diphenylpropan-2-yl)-2-(1-methylimidazol-2-yl)oxolan-3-amine |
| SMILES | Cn1ccnc1[C@H]1OCC[C@@H]1NC(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H27N3O/c1-26-14-13-24-23(26)22-21(12-15-27-22)25-20(16-18-8-4-2-5-9-18)17-19-10-6-3-7-11-19/h2-11,13-14,20-22,25H,12,15-17H2,1H3/t21-,22-/m0/s1 |
| InChIKey | RGXGREBJKOSNIL-VXKWHMMOSA-N |
| XLogP | 3.69 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |