C16H19NO2 — CID 15479532
(1R,2E)-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]hepta-2,6-dien-1-ol (PubChem CID 15479532) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is (1R,2E)-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]hepta-2,6-dien-1-ol.
| Compound Name | (1R,2E)-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]hepta-2,6-dien-1-ol |
|---|---|
| PubChem CID | 15479532 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (1R,2E)-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]hepta-2,6-dien-1-ol |
| SMILES | C=CCC/C=C/[C@@H](O)[C@@H]1COC(c2ccccc2)=N1 |
| InChI | InChI=1S/C16H19NO2/c1-2-3-4-8-11-15(18)14-12-19-16(17-14)13-9-6-5-7-10-13/h2,5-11,14-15,18H,1,3-4,12H2/b11-8+/t14-,15+/m0/s1 |
| InChIKey | BXSAORRGQRXLLO-QBKVNLCDSA-N |
| XLogP | 2.72 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|