About 2-(2,6-difluorophenyl)-N-(4-phenyl-1,3-oxazol-2-yl)acetamide
2-(2,6-difluorophenyl)-N-(4-phenyl-1,3-oxazol-2-yl)acetamide (PubChem CID 154796137) has the molecular formula C17H12F2N2O2
and a molecular weight of 314.29 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-N-(4-phenyl-1,3-oxazol-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-(2,6-difluorophenyl)-N-(4-phenyl-1,3-oxazol-2-yl)acetamide |
| PubChem CID | 154796137 |
| Molecular Formula | C17H12F2N2O2 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 2-(2,6-difluorophenyl)-N-(4-phenyl-1,3-oxazol-2-yl)acetamide |
| SMILES | O=C(Cc1c(F)cccc1F)Nc1nc(-c2ccccc2)co1 |
| InChI | InChI=1S/C17H12F2N2O2/c18-13-7-4-8-14(19)12(13)9-16(22)21-17-20-15(10-23-17)11-5-2-1-3-6-11/h1-8,10H,9H2,(H,20,21,22) |
| InChIKey | ZSAXEXAGXBKHMR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,6-difluorophenyl)-N-(4-phenyl-1,3-oxazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-difluorophenyl)-N-(4-phenyl-1,3-oxazol-2-yl)acetamide?
The IUPAC name of 2-(2,6-difluorophenyl)-N-(4-phenyl-1,3-oxazol-2-yl)acetamide (CID 154796137) is 2-(2,6-difluorophenyl)-N-(4-phenyl-1,3-oxazol-2-yl)acetamide.
What is the SMILES notation for 2-(2,6-difluorophenyl)-N-(4-phenyl-1,3-oxazol-2-yl)acetamide?
The canonical SMILES for 2-(2,6-difluorophenyl)-N-(4-phenyl-1,3-oxazol-2-yl)acetamide is O=C(Cc1c(F)cccc1F)Nc1nc(-c2ccccc2)co1.
What is the InChIKey of 2-(2,6-difluorophenyl)-N-(4-phenyl-1,3-oxazol-2-yl)acetamide?
The InChIKey is ZSAXEXAGXBKHMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12F2N2O2/c18-13-7-4-8-14(19)12(13)9-16(22)21-17-20-15(10-23-17)11-5-2-1-3-6-11/h1-8,10H,9H2,(H,20,21,22).
What are the key properties of 2-(2,6-difluorophenyl)-N-(4-phenyl-1,3-oxazol-2-yl)acetamide?
2-(2,6-difluorophenyl)-N-(4-phenyl-1,3-oxazol-2-yl)acetamide has a molecular weight of 314.29 g/mol, XLogP of 3.80, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-difluorophenyl)-N-(4-phenyl-1,3-oxazol-2-yl)acetamide is sourced from PubChem (CID 154796137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).