C25H20N4O4 — CID 154857983
2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)-N-(4-phenyl-1,3-oxazol-2-yl)acetamide (PubChem CID 154857983) has the molecular formula C25H20N4O4 and a molecular weight of 440.46 g/mol. Its IUPAC name is 2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)-N-(4-phenyl-1,3-oxazol-2-yl)acetamide.
| Compound Name | 2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)-N-(4-phenyl-1,3-oxazol-2-yl)acetamide |
|---|---|
| PubChem CID | 154857983 |
| Molecular Formula | C25H20N4O4 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)-N-(4-phenyl-1,3-oxazol-2-yl)acetamide |
| SMILES | CC1(c2ccc3ccccc3c2)NC(=O)N(CC(=O)Nc2nc(-c3ccccc3)co2)C1=O |
| InChI | InChI=1S/C25H20N4O4/c1-25(19-12-11-16-7-5-6-10-18(16)13-19)22(31)29(24(32)28-25)14-21(30)27-23-26-20(15-33-23)17-8-3-2-4-9-17/h2-13,15H,14H2,1H3,(H,28,32)(H,26,27,30) |
| InChIKey | ALZMJEYIAJNGPH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|