C15H15ClFN3O2S — CID 154797463
N-(5-chloro-1,3-thiazol-2-yl)-3-fluoro-4-(3-methylbutanoylamino)benzamide (PubChem CID 154797463) has the molecular formula C15H15ClFN3O2S and a molecular weight of 355.82 g/mol. Its IUPAC name is N-(5-chloro-1,3-thiazol-2-yl)-3-fluoro-4-(3-methylbutanoylamino)benzamide.
| Compound Name | N-(5-chloro-1,3-thiazol-2-yl)-3-fluoro-4-(3-methylbutanoylamino)benzamide |
|---|---|
| PubChem CID | 154797463 |
| Molecular Formula | C15H15ClFN3O2S |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | N-(5-chloro-1,3-thiazol-2-yl)-3-fluoro-4-(3-methylbutanoylamino)benzamide |
| SMILES | CC(C)CC(=O)Nc1ccc(C(=O)Nc2ncc(Cl)s2)cc1F |
| InChI | InChI=1S/C15H15ClFN3O2S/c1-8(2)5-13(21)19-11-4-3-9(6-10(11)17)14(22)20-15-18-7-12(16)23-15/h3-4,6-8H,5H2,1-2H3,(H,19,21)(H,18,20,22) |
| InChIKey | BHILUWZCFRQYNG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |