C17H30N4O — CID 154797944
2-[1-[(1-tert-butyltriazol-4-yl)methyl]pyrrolidin-2-yl]cyclohexan-1-ol (PubChem CID 154797944) has the molecular formula C17H30N4O and a molecular weight of 306.45 g/mol. Its IUPAC name is 2-[1-[(1-tert-butyltriazol-4-yl)methyl]pyrrolidin-2-yl]cyclohexan-1-ol.
| Compound Name | 2-[1-[(1-tert-butyltriazol-4-yl)methyl]pyrrolidin-2-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 154797944 |
| Molecular Formula | C17H30N4O |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | 2-[1-[(1-tert-butyltriazol-4-yl)methyl]pyrrolidin-2-yl]cyclohexan-1-ol |
| SMILES | CC(C)(C)n1cc(CN2CCCC2C2CCCCC2O)nn1 |
| InChI | InChI=1S/C17H30N4O/c1-17(2,3)21-12-13(18-19-21)11-20-10-6-8-15(20)14-7-4-5-9-16(14)22/h12,14-16,22H,4-11H2,1-3H3 |
| InChIKey | IDPCIYIAGAUWJJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |