C18H15N5O4S — CID 154798008
N-(3-benzoyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2-(3-nitro-1,2,4-triazol-1-yl)acetamide (PubChem CID 154798008) has the molecular formula C18H15N5O4S and a molecular weight of 397.42 g/mol. Its IUPAC name is N-(3-benzoyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2-(3-nitro-1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-(3-benzoyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 154798008 |
| Molecular Formula | C18H15N5O4S |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | N-(3-benzoyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
| SMILES | O=C(Cn1cnc([N+](=O)[O-])n1)Nc1sc2c(c1C(=O)c1ccccc1)CCC2 |
| InChI | InChI=1S/C18H15N5O4S/c24-14(9-22-10-19-18(21-22)23(26)27)20-17-15(12-7-4-8-13(12)28-17)16(25)11-5-2-1-3-6-11/h1-3,5-6,10H,4,7-9H2,(H,20,24) |
| InChIKey | GJRVDXGOCNMVNL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|