C18H18FN5O — CID 154798378
[3-[(4-fluoro-1-methylbenzimidazol-2-yl)amino]pyrrolidin-1-yl]-pyridin-3-ylmethanone (PubChem CID 154798378) has the molecular formula C18H18FN5O and a molecular weight of 339.37 g/mol. Its IUPAC name is [3-[(4-fluoro-1-methylbenzimidazol-2-yl)amino]pyrrolidin-1-yl]-pyridin-3-ylmethanone.
| Compound Name | [3-[(4-fluoro-1-methylbenzimidazol-2-yl)amino]pyrrolidin-1-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 154798378 |
| Molecular Formula | C18H18FN5O |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | [3-[(4-fluoro-1-methylbenzimidazol-2-yl)amino]pyrrolidin-1-yl]-pyridin-3-ylmethanone |
| SMILES | Cn1c(NC2CCN(C(=O)c3cccnc3)C2)nc2c(F)cccc21 |
| InChI | InChI=1S/C18H18FN5O/c1-23-15-6-2-5-14(19)16(15)22-18(23)21-13-7-9-24(11-13)17(25)12-4-3-8-20-10-12/h2-6,8,10,13H,7,9,11H2,1H3,(H,21,22) |
| InChIKey | UKCZNTLAAYKKLG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |