C18H17NO6S — CID 154799617
6-[2-(2-methoxyphenyl)sulfonylacetyl]-2-methyl-4H-1,4-benzoxazin-3-one (PubChem CID 154799617) has the molecular formula C18H17NO6S and a molecular weight of 375.40 g/mol. Its IUPAC name is 6-[2-(2-methoxyphenyl)sulfonylacetyl]-2-methyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-(2-methoxyphenyl)sulfonylacetyl]-2-methyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 154799617 |
| Molecular Formula | C18H17NO6S |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 6-[2-(2-methoxyphenyl)sulfonylacetyl]-2-methyl-4H-1,4-benzoxazin-3-one |
| SMILES | COc1ccccc1S(=O)(=O)CC(=O)c1ccc2c(c1)NC(=O)C(C)O2 |
| InChI | InChI=1S/C18H17NO6S/c1-11-18(21)19-13-9-12(7-8-15(13)25-11)14(20)10-26(22,23)17-6-4-3-5-16(17)24-2/h3-9,11H,10H2,1-2H3,(H,19,21) |
| InChIKey | DZLDBSKRKIKUKP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |