C17H20N4O3 — CID 154799653
1-[3-hydroxy-3-(2H-triazol-4-yl)pyrrolidin-1-yl]-3-(2-methoxyphenyl)but-2-en-1-one (PubChem CID 154799653) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is 1-[3-hydroxy-3-(2H-triazol-4-yl)pyrrolidin-1-yl]-3-(2-methoxyphenyl)but-2-en-1-one.
| Compound Name | 1-[3-hydroxy-3-(2H-triazol-4-yl)pyrrolidin-1-yl]-3-(2-methoxyphenyl)but-2-en-1-one |
|---|---|
| PubChem CID | 154799653 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 1-[3-hydroxy-3-(2H-triazol-4-yl)pyrrolidin-1-yl]-3-(2-methoxyphenyl)but-2-en-1-one |
| SMILES | COc1ccccc1C(C)=CC(=O)N1CCC(O)(c2cn[nH]n2)C1 |
| InChI | InChI=1S/C17H20N4O3/c1-12(13-5-3-4-6-14(13)24-2)9-16(22)21-8-7-17(23,11-21)15-10-18-20-19-15/h3-6,9-10,23H,7-8,11H2,1-2H3,(H,18,19,20) |
| InChIKey | OEROJBSVBIMBAG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|