C19H22N4O3 — CID 154802338
(2,3-dimethyl-1H-indol-7-yl)-[(2R,4S)-4-methoxy-2-(5-methyl-1,3,4-oxadiazol-2-yl)pyrrolidin-1-yl]methanone (PubChem CID 154802338) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is (2,3-dimethyl-1H-indol-7-yl)-[(2R,4S)-4-methoxy-2-(5-methyl-1,3,4-oxadiazol-2-yl)pyrrolidin-1-yl]methanone.
| Compound Name | (2,3-dimethyl-1H-indol-7-yl)-[(2R,4S)-4-methoxy-2-(5-methyl-1,3,4-oxadiazol-2-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 154802338 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (2,3-dimethyl-1H-indol-7-yl)-[(2R,4S)-4-methoxy-2-(5-methyl-1,3,4-oxadiazol-2-yl)pyrrolidin-1-yl]methanone |
| SMILES | CO[C@H]1C[C@H](c2nnc(C)o2)N(C(=O)c2cccc3c(C)c(C)[nH]c23)C1 |
| InChI | InChI=1S/C19H22N4O3/c1-10-11(2)20-17-14(10)6-5-7-15(17)19(24)23-9-13(25-4)8-16(23)18-22-21-12(3)26-18/h5-7,13,16,20H,8-9H2,1-4H3/t13-,16+/m0/s1 |
| InChIKey | FVLHRXIEJBYEHT-XJKSGUPXSA-N |
| XLogP | 3.08 |
| TPSA | 84.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|