C24H25N3O4 — CID 42323138
(1S,4S)-2-(2,5-dimethoxyphenyl)-5-(2,3-dimethyl-1H-indole-7-carbonyl)-2,5-diazabicyclo[2.2.1]heptan-3-one (PubChem CID 42323138) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is (1S,4S)-2-(2,5-dimethoxyphenyl)-5-(2,3-dimethyl-1H-indole-7-carbonyl)-2,5-diazabicyclo[2.2.1]heptan-3-one.
| Compound Name | (1S,4S)-2-(2,5-dimethoxyphenyl)-5-(2,3-dimethyl-1H-indole-7-carbonyl)-2,5-diazabicyclo[2.2.1]heptan-3-one |
|---|---|
| PubChem CID | 42323138 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | (1S,4S)-2-(2,5-dimethoxyphenyl)-5-(2,3-dimethyl-1H-indole-7-carbonyl)-2,5-diazabicyclo[2.2.1]heptan-3-one |
| SMILES | COc1ccc(OC)c(N2C(=O)[C@@H]3C[C@H]2CN3C(=O)c2cccc3c(C)c(C)[nH]c23)c1 |
| InChI | InChI=1S/C24H25N3O4/c1-13-14(2)25-22-17(13)6-5-7-18(22)23(28)26-12-15-10-20(26)24(29)27(15)19-11-16(30-3)8-9-21(19)31-4/h5-9,11,15,20,25H,10,12H2,1-4H3/t15-,20-/m0/s1 |
| InChIKey | KVLNYBQVUHXPHU-YWZLYKJASA-N |
| XLogP | 3.43 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|