C16H20N2O5S — CID 154805285
2-[4-(2-cyano-3,3-dimethylpiperidin-1-yl)sulfonylphenoxy]acetic acid (PubChem CID 154805285) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is 2-[4-(2-cyano-3,3-dimethylpiperidin-1-yl)sulfonylphenoxy]acetic acid.
| Compound Name | 2-[4-(2-cyano-3,3-dimethylpiperidin-1-yl)sulfonylphenoxy]acetic acid |
|---|---|
| PubChem CID | 154805285 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 2-[4-(2-cyano-3,3-dimethylpiperidin-1-yl)sulfonylphenoxy]acetic acid |
| SMILES | CC1(C)CCCN(S(=O)(=O)c2ccc(OCC(=O)O)cc2)C1C#N |
| InChI | InChI=1S/C16H20N2O5S/c1-16(2)8-3-9-18(14(16)10-17)24(21,22)13-6-4-12(5-7-13)23-11-15(19)20/h4-7,14H,3,8-9,11H2,1-2H3,(H,19,20) |
| InChIKey | RVLSSSBCKCABQO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 107.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |