C19H25NO4 — CID 136554249
2-[4-(3,3-dimethyl-2-prop-2-enylpiperidine-1-carbonyl)phenoxy]acetic acid (PubChem CID 136554249) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is 2-[4-(3,3-dimethyl-2-prop-2-enylpiperidine-1-carbonyl)phenoxy]acetic acid.
| Compound Name | 2-[4-(3,3-dimethyl-2-prop-2-enylpiperidine-1-carbonyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 136554249 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 2-[4-(3,3-dimethyl-2-prop-2-enylpiperidine-1-carbonyl)phenoxy]acetic acid |
| SMILES | C=CCC1N(C(=O)c2ccc(OCC(=O)O)cc2)CCCC1(C)C |
| InChI | InChI=1S/C19H25NO4/c1-4-6-16-19(2,3)11-5-12-20(16)18(23)14-7-9-15(10-8-14)24-13-17(21)22/h4,7-10,16H,1,5-6,11-13H2,2-3H3,(H,21,22) |
| InChIKey | ZTKNTERJFDKFQA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|