C17H23FN2O4S — CID 167925418
1-[(4-fluorosulfonyloxyphenyl)carbamoyl]-3,3-dimethyl-2-prop-2-enylpiperidine (PubChem CID 167925418) has the molecular formula C17H23FN2O4S and a molecular weight of 370.45 g/mol. Its IUPAC name is 1-[(4-fluorosulfonyloxyphenyl)carbamoyl]-3,3-dimethyl-2-prop-2-enylpiperidine.
| Compound Name | 1-[(4-fluorosulfonyloxyphenyl)carbamoyl]-3,3-dimethyl-2-prop-2-enylpiperidine |
|---|---|
| PubChem CID | 167925418 |
| Molecular Formula | C17H23FN2O4S |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 1-[(4-fluorosulfonyloxyphenyl)carbamoyl]-3,3-dimethyl-2-prop-2-enylpiperidine |
| SMILES | C=CCC1N(C(=O)Nc2ccc(OS(=O)(=O)F)cc2)CCCC1(C)C |
| InChI | InChI=1S/C17H23FN2O4S/c1-4-6-15-17(2,3)11-5-12-20(15)16(21)19-13-7-9-14(10-8-13)24-25(18,22)23/h4,7-10,15H,1,5-6,11-12H2,2-3H3,(H,19,21) |
| InChIKey | MPINRHJORNRVQU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|