C16H22FNO5S — CID 154872184
4-[(4-fluorosulfonyloxyphenyl)carbamoyl]-2,2,6,6-tetramethyloxane (PubChem CID 154872184) has the molecular formula C16H22FNO5S and a molecular weight of 359.42 g/mol. Its IUPAC name is 4-[(4-fluorosulfonyloxyphenyl)carbamoyl]-2,2,6,6-tetramethyloxane.
| Compound Name | 4-[(4-fluorosulfonyloxyphenyl)carbamoyl]-2,2,6,6-tetramethyloxane |
|---|---|
| PubChem CID | 154872184 |
| Molecular Formula | C16H22FNO5S |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 4-[(4-fluorosulfonyloxyphenyl)carbamoyl]-2,2,6,6-tetramethyloxane |
| SMILES | CC1(C)CC(C(=O)Nc2ccc(OS(=O)(=O)F)cc2)CC(C)(C)O1 |
| InChI | InChI=1S/C16H22FNO5S/c1-15(2)9-11(10-16(3,4)23-15)14(19)18-12-5-7-13(8-6-12)22-24(17,20)21/h5-8,11H,9-10H2,1-4H3,(H,18,19) |
| InChIKey | VKUMDANGQVWOGB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |