C18H26N2O — CID 129479602
1-[(2R)-3,3-dimethyl-2-prop-2-enylpiperidin-1-yl]-3-pyridin-2-ylpropan-1-one (PubChem CID 129479602) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is 1-[(2R)-3,3-dimethyl-2-prop-2-enylpiperidin-1-yl]-3-pyridin-2-ylpropan-1-one.
| Compound Name | 1-[(2R)-3,3-dimethyl-2-prop-2-enylpiperidin-1-yl]-3-pyridin-2-ylpropan-1-one |
|---|---|
| PubChem CID | 129479602 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 1-[(2R)-3,3-dimethyl-2-prop-2-enylpiperidin-1-yl]-3-pyridin-2-ylpropan-1-one |
| SMILES | C=CC[C@H]1N(C(=O)CCc2ccccn2)CCCC1(C)C |
| InChI | InChI=1S/C18H26N2O/c1-4-8-16-18(2,3)12-7-14-20(16)17(21)11-10-15-9-5-6-13-19-15/h4-6,9,13,16H,1,7-8,10-12,14H2,2-3H3/t16-/m1/s1 |
| InChIKey | JEXKFYBUBZGVFG-MRXNPFEDSA-N |
| XLogP | 3.61 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|