C25H24N6O2 — CID 154807018
4-(4-cyano-2-pyridinyl)-N-[2-methyl-5-(phenylcarbamoyl)phenyl]piperazine-1-carboxamide (PubChem CID 154807018) has the molecular formula C25H24N6O2 and a molecular weight of 440.51 g/mol. Its IUPAC name is 4-(4-cyano-2-pyridinyl)-N-[2-methyl-5-(phenylcarbamoyl)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-(4-cyano-2-pyridinyl)-N-[2-methyl-5-(phenylcarbamoyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 154807018 |
| Molecular Formula | C25H24N6O2 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 4-(4-cyano-2-pyridinyl)-N-[2-methyl-5-(phenylcarbamoyl)phenyl]piperazine-1-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2ccccc2)cc1NC(=O)N1CCN(c2cc(C#N)ccn2)CC1 |
| InChI | InChI=1S/C25H24N6O2/c1-18-7-8-20(24(32)28-21-5-3-2-4-6-21)16-22(18)29-25(33)31-13-11-30(12-14-31)23-15-19(17-26)9-10-27-23/h2-10,15-16H,11-14H2,1H3,(H,28,32)(H,29,33) |
| InChIKey | OGCYAMPELRBRAA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |